C18H18N2 — CID 142949785
N-[(3E)-hexa-1,3,5-trien-3-yl]-6-methyl-N-phenylpyridin-3-amine (PubChem CID 142949785) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is N-[(3E)-hexa-1,3,5-trien-3-yl]-6-methyl-N-phenylpyridin-3-amine.
| Compound Name | N-[(3E)-hexa-1,3,5-trien-3-yl]-6-methyl-N-phenylpyridin-3-amine |
|---|---|
| PubChem CID | 142949785 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-[(3E)-hexa-1,3,5-trien-3-yl]-6-methyl-N-phenylpyridin-3-amine |
| SMILES | C=C/C=C(\C=C)N(c1ccccc1)c1ccc(C)nc1 |
| InChI | InChI=1S/C18H18N2/c1-4-9-16(5-2)20(17-10-7-6-8-11-17)18-13-12-15(3)19-14-18/h4-14H,1-2H2,3H3/b16-9+ |
| InChIKey | STORNVLYWHANAD-CXUHLZMHSA-N |
| XLogP | 4.78 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|