C24H23NOS2 — CID 145446536
5-[4-(N-[(3E)-hexa-1,3,5-trien-3-yl]anilino)phenyl]thiophene-2-carbaldehyde;methanethiol (PubChem CID 145446536) has the molecular formula C24H23NOS2 and a molecular weight of 405.59 g/mol. Its IUPAC name is 5-[4-(N-[(3E)-hexa-1,3,5-trien-3-yl]anilino)phenyl]thiophene-2-carbaldehyde;methanethiol.
| Compound Name | 5-[4-(N-[(3E)-hexa-1,3,5-trien-3-yl]anilino)phenyl]thiophene-2-carbaldehyde;methanethiol |
|---|---|
| PubChem CID | 145446536 |
| Molecular Formula | C24H23NOS2 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 5-[4-(N-[(3E)-hexa-1,3,5-trien-3-yl]anilino)phenyl]thiophene-2-carbaldehyde;methanethiol |
| SMILES | C=C/C=C(\C=C)N(c1ccccc1)c1ccc(-c2ccc(C=O)s2)cc1.CS |
| InChI | InChI=1S/C23H19NOS.CH4S/c1-3-8-19(4-2)24(20-9-6-5-7-10-20)21-13-11-18(12-14-21)23-16-15-22(17-25)26-23;1-2/h3-17H,1-2H2;2H,1H3/b19-8+; |
| InChIKey | YWNMOVDJNUOBBC-BTSUEJIHSA-N |
| XLogP | 7.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|