C36H36N2 — CID 130421401
N-[(3E)-hexa-1,3,5-trien-3-yl]-N-[(2E)-penta-2,4-dien-2-yl]-4-[(2E,4E)-5-(N-phenylanilino)hepta-2,4,6-trien-2-yl]aniline (PubChem CID 130421401) has the molecular formula C36H36N2 and a molecular weight of 496.70 g/mol. Its IUPAC name is N-[(3E)-hexa-1,3,5-trien-3-yl]-N-[(2E)-penta-2,4-dien-2-yl]-4-[(2E,4E)-5-(N-phenylanilino)hepta-2,4,6-trien-2-yl]aniline.
| Compound Name | N-[(3E)-hexa-1,3,5-trien-3-yl]-N-[(2E)-penta-2,4-dien-2-yl]-4-[(2E,4E)-5-(N-phenylanilino)hepta-2,4,6-trien-2-yl]aniline |
|---|---|
| PubChem CID | 130421401 |
| Molecular Formula | C36H36N2 |
| Molecular Weight | 496.70 g/mol |
| Exact Mass | 496.29 |
| IUPAC Name | N-[(3E)-hexa-1,3,5-trien-3-yl]-N-[(2E)-penta-2,4-dien-2-yl]-4-[(2E,4E)-5-(N-phenylanilino)hepta-2,4,6-trien-2-yl]aniline |
| SMILES | C=C/C=C(\C)N(/C(C=C)=C/C=C)c1ccc(/C(C)=C/C=C(\C=C)N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H36N2/c1-7-17-30(6)37(32(9-3)18-8-2)36-27-24-31(25-28-36)29(5)23-26-33(10-4)38(34-19-13-11-14-20-34)35-21-15-12-16-22-35/h7-28H,1-4H2,5-6H3/b29-23+,30-17+,32-18+,33-26+ |
| InChIKey | FEDGOSOSVXXRNE-SDYZAFCJSA-N |
| XLogP | 10.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.70 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|