C24H39N — CID 142868290
ethane;N-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-[(3E)-hexa-1,3,5-trien-3-yl]aniline (PubChem CID 142868290) has the molecular formula C24H39N and a molecular weight of 341.58 g/mol. Its IUPAC name is ethane;N-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-[(3E)-hexa-1,3,5-trien-3-yl]aniline.
| Compound Name | ethane;N-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-[(3E)-hexa-1,3,5-trien-3-yl]aniline |
|---|---|
| PubChem CID | 142868290 |
| Molecular Formula | C24H39N |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 341.31 |
| IUPAC Name | ethane;N-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-[(3E)-hexa-1,3,5-trien-3-yl]aniline |
| SMILES | C=C/C=C(\C=C)N(C(/C=C\C)=C/C)c1ccccc1.CC.CC.CC |
| InChI | InChI=1S/C18H21N.3C2H6/c1-5-12-16(7-3)19(17(8-4)13-6-2)18-14-10-9-11-15-18;3*1-2/h5-15H,1,3H2,2,4H3;3*1-2H3/b13-6-,16-12+,17-8+;;; |
| InChIKey | GHNQISZXRCVJTI-OHSHLTPYSA-N |
| XLogP | 8.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|