C41H41N — CID 142935509
N-[(2E,4Z)-6-[10-[(3E,5Z)-hepta-1,3,5-trien-4-yl]anthracen-9-yl]hexa-2,4-dien-3-yl]-N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]aniline (PubChem CID 142935509) has the molecular formula C41H41N and a molecular weight of 547.79 g/mol. Its IUPAC name is N-[(2E,4Z)-6-[10-[(3E,5Z)-hepta-1,3,5-trien-4-yl]anthracen-9-yl]hexa-2,4-dien-3-yl]-N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]aniline.
| Compound Name | N-[(2E,4Z)-6-[10-[(3E,5Z)-hepta-1,3,5-trien-4-yl]anthracen-9-yl]hexa-2,4-dien-3-yl]-N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]aniline |
|---|---|
| PubChem CID | 142935509 |
| Molecular Formula | C41H41N |
| Molecular Weight | 547.79 g/mol |
| Exact Mass | 547.32 |
| IUPAC Name | N-[(2E,4Z)-6-[10-[(3E,5Z)-hepta-1,3,5-trien-4-yl]anthracen-9-yl]hexa-2,4-dien-3-yl]-N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]aniline |
| SMILES | C=C/C=C(\C=C/C)c1c2ccccc2c(C/C=C\C(=C/C)N(C(/C=C\C)=C/C=C\C)c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C41H41N/c1-6-11-23-34(22-9-4)42(35-24-13-12-14-25-35)33(10-5)26-19-31-36-37-27-15-17-29-39(37)41(32(20-7-2)21-8-3)40-30-18-16-28-38(36)40/h6-30H,2,31H2,1,3-5H3/b11-6-,21-8-,22-9-,26-19-,32-20+,33-10+,34-23+ |
| InChIKey | JYEFDPGACRZQJX-QTASUYTESA-N |
| XLogP | 11.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.79 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|