C41H46N2 — CID 144687213
N-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-[4-[4-[[(2E,4Z)-hexa-2,4-dien-3-yl]-[(3E)-hexa-1,3-dien-3-yl]amino]phenyl]phenyl]-N-[(2E)-penta-2,4-dien-2-yl]aniline (PubChem CID 144687213) has the molecular formula C41H46N2 and a molecular weight of 566.83 g/mol. Its IUPAC name is N-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-[4-[4-[[(2E,4Z)-hexa-2,4-dien-3-yl]-[(3E)-hexa-1,3-dien-3-yl]amino]phenyl]phenyl]-N-[(2E)-penta-2,4-dien-2-yl]aniline.
| Compound Name | N-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-[4-[4-[[(2E,4Z)-hexa-2,4-dien-3-yl]-[(3E)-hexa-1,3-dien-3-yl]amino]phenyl]phenyl]-N-[(2E)-penta-2,4-dien-2-yl]aniline |
|---|---|
| PubChem CID | 144687213 |
| Molecular Formula | C41H46N2 |
| Molecular Weight | 566.83 g/mol |
| Exact Mass | 566.37 |
| IUPAC Name | N-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-[4-[4-[[(2E,4Z)-hexa-2,4-dien-3-yl]-[(3E)-hexa-1,3-dien-3-yl]amino]phenyl]phenyl]-N-[(2E)-penta-2,4-dien-2-yl]aniline |
| SMILES | C=C/C=C(\C)N(/C(C)=C/C=C\C)c1ccc(-c2ccc(-c3ccc(N(/C(C=C)=C/CC)C(/C=C\C)=C/C)cc3)cc2)cc1 |
| InChI | InChI=1S/C41H46N2/c1-9-15-19-33(8)42(32(7)16-10-2)40-28-24-36(25-29-40)34-20-22-35(23-21-34)37-26-30-41(31-27-37)43(38(13-5)17-11-3)39(14-6)18-12-4/h9-10,12-31H,2,5,11H2,1,3-4,6-8H3/b15-9-,18-12-,32-16+,33-19+,38-17+,39-14+ |
| InChIKey | AKOGOWANNHJDLK-AOBLGYCYSA-N |
| XLogP | 12.16 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.83 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|