C21H27N — CID 144619681
N-[(2E,4Z)-hepta-2,4-dien-3-yl]-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4-methylaniline (PubChem CID 144619681) has the molecular formula C21H27N and a molecular weight of 293.45 g/mol. Its IUPAC name is N-[(2E,4Z)-hepta-2,4-dien-3-yl]-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4-methylaniline.
| Compound Name | N-[(2E,4Z)-hepta-2,4-dien-3-yl]-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4-methylaniline |
|---|---|
| PubChem CID | 144619681 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | N-[(2E,4Z)-hepta-2,4-dien-3-yl]-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4-methylaniline |
| SMILES | C=C/C=C\C(=C/C)N(C(/C=C\CC)=C/C)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H27N/c1-6-10-12-19(8-3)22(20(9-4)13-11-7-2)21-16-14-18(5)15-17-21/h6,8-17H,1,7H2,2-5H3/b12-10-,13-11-,19-8+,20-9+ |
| InChIKey | CAEFFJKVIJQKPI-CUBKDNCTSA-N |
| XLogP | 6.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|