C39H39N3 — CID 134447766
1-N-[(2Z,4E)-4-(N-[(3E,5Z)-octa-3,5,7-trien-4-yl]anilino)hepta-2,4,6-trienyl]-4-N,4-N-diphenylbenzene-1,4-diamine (PubChem CID 134447766) has the molecular formula C39H39N3 and a molecular weight of 549.76 g/mol. Its IUPAC name is 1-N-[(2Z,4E)-4-(N-[(3E,5Z)-octa-3,5,7-trien-4-yl]anilino)hepta-2,4,6-trienyl]-4-N,4-N-diphenylbenzene-1,4-diamine.
| Compound Name | 1-N-[(2Z,4E)-4-(N-[(3E,5Z)-octa-3,5,7-trien-4-yl]anilino)hepta-2,4,6-trienyl]-4-N,4-N-diphenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 134447766 |
| Molecular Formula | C39H39N3 |
| Molecular Weight | 549.76 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | 1-N-[(2Z,4E)-4-(N-[(3E,5Z)-octa-3,5,7-trien-4-yl]anilino)hepta-2,4,6-trienyl]-4-N,4-N-diphenylbenzene-1,4-diamine |
| SMILES | C=C/C=C\C(=C/CC)N(C(/C=C\CNc1ccc(N(c2ccccc2)c2ccccc2)cc1)=C/C=C)c1ccccc1 |
| InChI | InChI=1S/C39H39N3/c1-4-7-20-34(18-5-2)41(36-21-11-8-12-22-36)35(19-6-3)27-17-32-40-33-28-30-39(31-29-33)42(37-23-13-9-14-24-37)38-25-15-10-16-26-38/h4,6-31,40H,1,3,5,32H2,2H3/b20-7-,27-17-,34-18+,35-19+ |
| InChIKey | YKFALYLIGXWBOP-SNETZPPPSA-N |
| XLogP | 10.74 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.76 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|