C14H14BN — CID 174034385
CID 174034385 (PubChem CID 174034385) has the molecular formula C14H14BN and a molecular weight of 207.08 g/mol.
| Compound Name | CID 174034385 |
|---|---|
| PubChem CID | 174034385 |
| Molecular Formula | C14H14BN |
| Molecular Weight | 207.08 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | — |
| SMILES | [B]N(C(/C=C\C=C)=C/C=C)c1ccccc1 |
| InChI | InChI=1S/C14H14BN/c1-3-5-10-13(9-4-2)16(15)14-11-7-6-8-12-14/h3-12H,1-2H2/b10-5-,13-9+ |
| InChIKey | LCKRVBFHPAYEAY-GXCNYSEGSA-N |
| XLogP | 3.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.08 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|