C13H14IN — CID 170206355
N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N-iodoaniline (PubChem CID 170206355) has the molecular formula C13H14IN and a molecular weight of 311.17 g/mol. Its IUPAC name is N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N-iodoaniline.
| Compound Name | N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N-iodoaniline |
|---|---|
| PubChem CID | 170206355 |
| Molecular Formula | C13H14IN |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N-iodoaniline |
| SMILES | C=C/C=C\C=C(/C)N(I)c1ccccc1 |
| InChI | InChI=1S/C13H14IN/c1-3-4-6-9-12(2)15(14)13-10-7-5-8-11-13/h3-11H,1H2,2H3/b6-4-,12-9+ |
| InChIKey | QVUZTUDECCXLOU-YWYLEKLXSA-N |
| XLogP | 4.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|