C25H23N — CID 88961504
N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N,4-diphenylaniline (PubChem CID 88961504) has the molecular formula C25H23N and a molecular weight of 337.47 g/mol. Its IUPAC name is N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N,4-diphenylaniline.
| Compound Name | N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N,4-diphenylaniline |
|---|---|
| PubChem CID | 88961504 |
| Molecular Formula | C25H23N |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N,4-diphenylaniline |
| SMILES | C=C/C=C\C=C(/C)N(c1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H23N/c1-3-4-7-12-21(2)26(24-15-10-6-11-16-24)25-19-17-23(18-20-25)22-13-8-5-9-14-22/h3-20H,1H2,2H3/b7-4-,21-12+ |
| InChIKey | GKZDSLVLJXNSMF-QDMWJLNPSA-N |
| XLogP | 7.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|