C28H33N — CID 89264612
N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N-[(2E)-4-methylhepta-2,6-dien-2-yl]-4-(4-methylphenyl)aniline (PubChem CID 89264612) has the molecular formula C28H33N and a molecular weight of 383.58 g/mol. Its IUPAC name is N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N-[(2E)-4-methylhepta-2,6-dien-2-yl]-4-(4-methylphenyl)aniline.
| Compound Name | N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N-[(2E)-4-methylhepta-2,6-dien-2-yl]-4-(4-methylphenyl)aniline |
|---|---|
| PubChem CID | 89264612 |
| Molecular Formula | C28H33N |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N-[(2E)-4-methylhepta-2,6-dien-2-yl]-4-(4-methylphenyl)aniline |
| SMILES | C=C/C=C\C=C(/C)N(/C(C)=C/C(C)CC=C)c1ccc(-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H33N/c1-7-9-10-12-24(5)29(25(6)21-23(4)11-8-2)28-19-17-27(18-20-28)26-15-13-22(3)14-16-26/h7-10,12-21,23H,1-2,11H2,3-6H3/b10-9-,24-12+,25-21+ |
| InChIKey | RJWGJGPTFCIDTQ-VUEGLYDTSA-N |
| XLogP | 8.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|