C27H27N — CID 89229629
N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-methyl-N-[4-(4-methylphenyl)phenyl]aniline (PubChem CID 89229629) has the molecular formula C27H27N and a molecular weight of 365.52 g/mol. Its IUPAC name is N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-methyl-N-[4-(4-methylphenyl)phenyl]aniline.
| Compound Name | N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-methyl-N-[4-(4-methylphenyl)phenyl]aniline |
|---|---|
| PubChem CID | 89229629 |
| Molecular Formula | C27H27N |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-methyl-N-[4-(4-methylphenyl)phenyl]aniline |
| SMILES | C=C/C=C\C=C(/C)N(c1ccc(-c2ccc(C)cc2)cc1)c1cccc(C)c1 |
| InChI | InChI=1S/C27H27N/c1-5-6-7-10-23(4)28(27-11-8-9-22(3)20-27)26-18-16-25(17-19-26)24-14-12-21(2)13-15-24/h5-20H,1H2,2-4H3/b7-6-,23-10+ |
| InChIKey | OMOIDCBUTOCPNI-KUYWJJDUSA-N |
| XLogP | 7.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|