C12H15N — CID 172568637
N-[(1Z)-buta-1,3-dienyl]-N,3-dimethylaniline (PubChem CID 172568637) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is N-[(1Z)-buta-1,3-dienyl]-N,3-dimethylaniline.
| Compound Name | N-[(1Z)-buta-1,3-dienyl]-N,3-dimethylaniline |
|---|---|
| PubChem CID | 172568637 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | N-[(1Z)-buta-1,3-dienyl]-N,3-dimethylaniline |
| SMILES | C=C/C=C\N(C)c1cccc(C)c1 |
| InChI | InChI=1S/C12H15N/c1-4-5-9-13(3)12-8-6-7-11(2)10-12/h4-10H,1H2,2-3H3/b9-5- |
| InChIKey | LNMUIHRSTQANRH-UITAMQMPSA-N |
| XLogP | 3.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|