C11H14N2 — CID 118297015
N-[(Z)-3-iminoprop-1-enyl]-N,3-dimethylaniline (PubChem CID 118297015) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is N-[(Z)-3-iminoprop-1-enyl]-N,3-dimethylaniline.
| Compound Name | N-[(Z)-3-iminoprop-1-enyl]-N,3-dimethylaniline |
|---|---|
| PubChem CID | 118297015 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | N-[(Z)-3-iminoprop-1-enyl]-N,3-dimethylaniline |
| SMILES | [H]/N=C/C=C\N(C)c1cccc(C)c1 |
| InChI | InChI=1S/C11H14N2/c1-10-5-3-6-11(9-10)13(2)8-4-7-12/h3-9,12H,1-2H3/b8-4-,12-7+ |
| InChIKey | IRNDFOUXVFKQEZ-OPVKSPCESA-N |
| XLogP | 2.59 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|