C17H22N2 — CID 144735633
1-N,3-N-bis[(1Z)-buta-1,3-dienyl]-1-N,3-N,2-trimethylbenzene-1,3-diamine (PubChem CID 144735633) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 1-N,3-N-bis[(1Z)-buta-1,3-dienyl]-1-N,3-N,2-trimethylbenzene-1,3-diamine.
| Compound Name | 1-N,3-N-bis[(1Z)-buta-1,3-dienyl]-1-N,3-N,2-trimethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 144735633 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 1-N,3-N-bis[(1Z)-buta-1,3-dienyl]-1-N,3-N,2-trimethylbenzene-1,3-diamine |
| SMILES | C=C/C=C\N(C)c1cccc(N(C)/C=C\C=C)c1C |
| InChI | InChI=1S/C17H22N2/c1-6-8-13-18(4)16-11-10-12-17(15(16)3)19(5)14-9-7-2/h6-14H,1-2H2,3-5H3/b13-8-,14-9- |
| InChIKey | JZRSIHILZSLIHL-QKPPEBSVSA-N |
| XLogP | 4.27 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|