C9H12BrN — CID 107640986
3-bromo-N,N,2-trimethylaniline (PubChem CID 107640986) has the molecular formula C9H12BrN and a molecular weight of 214.11 g/mol. Its IUPAC name is 3-bromo-N,N,2-trimethylaniline.
| Compound Name | 3-bromo-N,N,2-trimethylaniline |
|---|---|
| PubChem CID | 107640986 |
| Molecular Formula | C9H12BrN |
| Molecular Weight | 214.11 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | 3-bromo-N,N,2-trimethylaniline |
| SMILES | Cc1c(Br)cccc1N(C)C |
| InChI | InChI=1S/C9H12BrN/c1-7-8(10)5-4-6-9(7)11(2)3/h4-6H,1-3H3 |
| InChIKey | PTRNTUVHQOBEAC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.11 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |