C9H12BrNO2S — CID 162727630
3-bromo-N,N,2-trimethylbenzenesulfonamide (PubChem CID 162727630) has the molecular formula C9H12BrNO2S and a molecular weight of 278.17 g/mol. Its IUPAC name is 3-bromo-N,N,2-trimethylbenzenesulfonamide.
| Compound Name | 3-bromo-N,N,2-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 162727630 |
| Molecular Formula | C9H12BrNO2S |
| Molecular Weight | 278.17 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | 3-bromo-N,N,2-trimethylbenzenesulfonamide |
| SMILES | Cc1c(Br)cccc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C9H12BrNO2S/c1-7-8(10)5-4-6-9(7)14(12,13)11(2)3/h4-6H,1-3H3 |
| InChIKey | FQFKTLOUTYBPQW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.17 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |