C13H16N2O4S2 — CID 54107174
1-N,1-N,5-N-trimethylnaphthalene-1,5-disulfonamide (PubChem CID 54107174) has the molecular formula C13H16N2O4S2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 1-N,1-N,5-N-trimethylnaphthalene-1,5-disulfonamide.
| Compound Name | 1-N,1-N,5-N-trimethylnaphthalene-1,5-disulfonamide |
|---|---|
| PubChem CID | 54107174 |
| Molecular Formula | C13H16N2O4S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 1-N,1-N,5-N-trimethylnaphthalene-1,5-disulfonamide |
| SMILES | CNS(=O)(=O)c1cccc2c(S(=O)(=O)N(C)C)cccc12 |
| InChI | InChI=1S/C13H16N2O4S2/c1-14-20(16,17)12-8-4-7-11-10(12)6-5-9-13(11)21(18,19)15(2)3/h4-9,14H,1-3H3 |
| InChIKey | NEOHHEDTENBLRI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |