C16H20N2O4S — CID 11739198
tert-butyl N-[5-(methylsulfamoyl)naphthalen-1-yl]carbamate (PubChem CID 11739198) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is tert-butyl N-[5-(methylsulfamoyl)naphthalen-1-yl]carbamate.
| Compound Name | tert-butyl N-[5-(methylsulfamoyl)naphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 11739198 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | tert-butyl N-[5-(methylsulfamoyl)naphthalen-1-yl]carbamate |
| SMILES | CNS(=O)(=O)c1cccc2c(NC(=O)OC(C)(C)C)cccc12 |
| InChI | InChI=1S/C16H20N2O4S/c1-16(2,3)22-15(19)18-13-9-5-8-12-11(13)7-6-10-14(12)23(20,21)17-4/h5-10,17H,1-4H3,(H,18,19) |
| InChIKey | UERGDMKAWGUCAM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |