C15H17BrN2O4S — CID 44549792
tert-butyl N-(1-bromo-5-sulfamoylnaphthalen-2-yl)carbamate (PubChem CID 44549792) has the molecular formula C15H17BrN2O4S and a molecular weight of 401.28 g/mol. Its IUPAC name is tert-butyl N-(1-bromo-5-sulfamoylnaphthalen-2-yl)carbamate.
| Compound Name | tert-butyl N-(1-bromo-5-sulfamoylnaphthalen-2-yl)carbamate |
|---|---|
| PubChem CID | 44549792 |
| Molecular Formula | C15H17BrN2O4S |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | tert-butyl N-(1-bromo-5-sulfamoylnaphthalen-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc2c(S(N)(=O)=O)cccc2c1Br |
| InChI | InChI=1S/C15H17BrN2O4S/c1-15(2,3)22-14(19)18-11-8-7-9-10(13(11)16)5-4-6-12(9)23(17,20)21/h4-8H,1-3H3,(H,18,19)(H2,17,20,21) |
| InChIKey | WVJZERPKSOLCEP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |