C14H16N2O4S — CID 91728656
N-[6-(dimethylsulfamoyl)-5-hydroxynaphthalen-1-yl]acetamide (PubChem CID 91728656) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is N-[6-(dimethylsulfamoyl)-5-hydroxynaphthalen-1-yl]acetamide.
| Compound Name | N-[6-(dimethylsulfamoyl)-5-hydroxynaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 91728656 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-[6-(dimethylsulfamoyl)-5-hydroxynaphthalen-1-yl]acetamide |
| SMILES | CC(=O)Nc1cccc2c(O)c(S(=O)(=O)N(C)C)ccc12 |
| InChI | InChI=1S/C14H16N2O4S/c1-9(17)15-12-6-4-5-11-10(12)7-8-13(14(11)18)21(19,20)16(2)3/h4-8,18H,1-3H3,(H,15,17) |
| InChIKey | CEROGYQBZDPTAX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |