C12H12N2O3S — CID 3403698
N-(5-sulfamoylnaphthalen-1-yl)acetamide (PubChem CID 3403698) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is N-(5-sulfamoylnaphthalen-1-yl)acetamide.
| Compound Name | N-(5-sulfamoylnaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 3403698 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | N-(5-sulfamoylnaphthalen-1-yl)acetamide |
| SMILES | CC(=O)Nc1cccc2c(S(N)(=O)=O)cccc12 |
| InChI | InChI=1S/C12H12N2O3S/c1-8(15)14-11-6-2-5-10-9(11)4-3-7-12(10)18(13,16)17/h2-7H,1H3,(H,14,15)(H2,13,16,17) |
| InChIKey | OXGMADUQTHJYOL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |