C19H16Cl2N2O3S — CID 69118403
N-[5-[(3,4-dichlorophenyl)methylsulfamoyl]naphthalen-1-yl]acetamide (PubChem CID 69118403) has the molecular formula C19H16Cl2N2O3S and a molecular weight of 423.32 g/mol. Its IUPAC name is N-[5-[(3,4-dichlorophenyl)methylsulfamoyl]naphthalen-1-yl]acetamide.
| Compound Name | N-[5-[(3,4-dichlorophenyl)methylsulfamoyl]naphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 69118403 |
| Molecular Formula | C19H16Cl2N2O3S |
| Molecular Weight | 423.32 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | N-[5-[(3,4-dichlorophenyl)methylsulfamoyl]naphthalen-1-yl]acetamide |
| SMILES | CC(=O)Nc1cccc2c(S(=O)(=O)NCc3ccc(Cl)c(Cl)c3)cccc12 |
| InChI | InChI=1S/C19H16Cl2N2O3S/c1-12(24)23-18-6-2-5-15-14(18)4-3-7-19(15)27(25,26)22-11-13-8-9-16(20)17(21)10-13/h2-10,22H,11H2,1H3,(H,23,24) |
| InChIKey | QRUCGMUUGJIYIS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.32 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |