C21H27N3O5S — CID 69028182
[4-[[(5-acetamidonaphthalen-1-yl)sulfonylamino]methyl]cyclohexyl]methylcarbamic acid (PubChem CID 69028182) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is [4-[[(5-acetamidonaphthalen-1-yl)sulfonylamino]methyl]cyclohexyl]methylcarbamic acid.
| Compound Name | [4-[[(5-acetamidonaphthalen-1-yl)sulfonylamino]methyl]cyclohexyl]methylcarbamic acid |
|---|---|
| PubChem CID | 69028182 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | [4-[[(5-acetamidonaphthalen-1-yl)sulfonylamino]methyl]cyclohexyl]methylcarbamic acid |
| SMILES | CC(=O)Nc1cccc2c(S(=O)(=O)NCC3CCC(CNC(=O)O)CC3)cccc12 |
| InChI | InChI=1S/C21H27N3O5S/c1-14(25)24-19-6-2-5-18-17(19)4-3-7-20(18)30(28,29)23-13-16-10-8-15(9-11-16)12-22-21(26)27/h2-7,15-16,22-23H,8-13H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | HEPNJGDPMYGYBV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |