C20H26N2O4S — CID 53496159
4-[[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 53496159) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is 4-[[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 53496159 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 4-[[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NCC3CCC(C(=O)O)CC3)cccc12 |
| InChI | InChI=1S/C20H26N2O4S/c1-22(2)18-7-3-6-17-16(18)5-4-8-19(17)27(25,26)21-13-14-9-11-15(12-10-14)20(23)24/h3-8,14-15,21H,9-13H2,1-2H3,(H,23,24) |
| InChIKey | IGAWEQUFPYSZJH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |