C26H37N3O5S — CID 53496160
4-[[6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexanoylamino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 53496160) has the molecular formula C26H37N3O5S and a molecular weight of 503.67 g/mol. Its IUPAC name is 4-[[6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexanoylamino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexanoylamino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 53496160 |
| Molecular Formula | C26H37N3O5S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | 4-[[6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexanoylamino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NCCCCCC(=O)NCC3CCC(C(=O)O)CC3)cccc12 |
| InChI | InChI=1S/C26H37N3O5S/c1-29(2)23-10-6-9-22-21(23)8-7-11-24(22)35(33,34)28-17-5-3-4-12-25(30)27-18-19-13-15-20(16-14-19)26(31)32/h6-11,19-20,28H,3-5,12-18H2,1-2H3,(H,27,30)(H,31,32) |
| InChIKey | YEAOWCYVOHJCOT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|