C24H36FN3O5S — CID 132555044
5-(dimethylamino)-N-[6-[(3S,4R,5R)-3-fluoro-4,5-dihydroxy-3-(hydroxymethyl)piperidin-1-yl]hexyl]naphthalene-1-sulfonamide (PubChem CID 132555044) has the molecular formula C24H36FN3O5S and a molecular weight of 497.63 g/mol. Its IUPAC name is 5-(dimethylamino)-N-[6-[(3S,4R,5R)-3-fluoro-4,5-dihydroxy-3-(hydroxymethyl)piperidin-1-yl]hexyl]naphthalene-1-sulfonamide.
| Compound Name | 5-(dimethylamino)-N-[6-[(3S,4R,5R)-3-fluoro-4,5-dihydroxy-3-(hydroxymethyl)piperidin-1-yl]hexyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 132555044 |
| Molecular Formula | C24H36FN3O5S |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | 5-(dimethylamino)-N-[6-[(3S,4R,5R)-3-fluoro-4,5-dihydroxy-3-(hydroxymethyl)piperidin-1-yl]hexyl]naphthalene-1-sulfonamide |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NCCCCCCN3C[C@@H](O)[C@@H](O)[C@@](F)(CO)C3)cccc12 |
| InChI | InChI=1S/C24H36FN3O5S/c1-27(2)20-11-7-10-19-18(20)9-8-12-22(19)34(32,33)26-13-5-3-4-6-14-28-15-21(30)23(31)24(25,16-28)17-29/h7-12,21,23,26,29-31H,3-6,13-17H2,1-2H3/t21-,23-,24+/m1/s1 |
| InChIKey | BMVQKTOAYHGYPY-JRFVFWCSSA-N |
| XLogP | 1.48 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|