C21H28N6O3S — CID 59828197
N-[5-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]pentyl]-1-methyltriazole-4-carboxamide (PubChem CID 59828197) has the molecular formula C21H28N6O3S and a molecular weight of 444.56 g/mol. Its IUPAC name is N-[5-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]pentyl]-1-methyltriazole-4-carboxamide.
| Compound Name | N-[5-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]pentyl]-1-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 59828197 |
| Molecular Formula | C21H28N6O3S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | N-[5-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]pentyl]-1-methyltriazole-4-carboxamide |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NCCCCCNC(=O)c3cn(C)nn3)cccc12 |
| InChI | InChI=1S/C21H28N6O3S/c1-26(2)19-11-7-10-17-16(19)9-8-12-20(17)31(29,30)23-14-6-4-5-13-22-21(28)18-15-27(3)25-24-18/h7-12,15,23H,4-6,13-14H2,1-3H3,(H,22,28) |
| InChIKey | RBQNTGSPHUFNKW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|