C29H50N8O3S — CID 70658039
N-[3-[4-[3-(diaminomethylideneamino)propylamino]butylamino]propyl]-6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexanamide (PubChem CID 70658039) has the molecular formula C29H50N8O3S and a molecular weight of 590.84 g/mol. Its IUPAC name is N-[3-[4-[3-(diaminomethylideneamino)propylamino]butylamino]propyl]-6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexanamide.
| Compound Name | N-[3-[4-[3-(diaminomethylideneamino)propylamino]butylamino]propyl]-6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexanamide |
|---|---|
| PubChem CID | 70658039 |
| Molecular Formula | C29H50N8O3S |
| Molecular Weight | 590.84 g/mol |
| Exact Mass | 590.37 |
| IUPAC Name | N-[3-[4-[3-(diaminomethylideneamino)propylamino]butylamino]propyl]-6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexanamide |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NCCCCCC(=O)NCCCNCCCCNCCCN=C(N)N)cccc12 |
| InChI | InChI=1S/C29H50N8O3S/c1-37(2)26-14-8-13-25-24(26)12-9-15-27(25)41(39,40)36-23-5-3-4-16-28(38)34-21-10-19-32-17-6-7-18-33-20-11-22-35-29(30)31/h8-9,12-15,32-33,36H,3-7,10-11,16-23H2,1-2H3,(H,34,38)(H4,30,31,35) |
| InChIKey | QTGYNHVAODZERT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 166.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.84 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|