C22H31N5O4S — CID 54418264
but-2-enyl (2S)-5-(diaminomethylideneamino)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]pentanoate (PubChem CID 54418264) has the molecular formula C22H31N5O4S and a molecular weight of 461.59 g/mol. Its IUPAC name is but-2-enyl (2S)-5-(diaminomethylideneamino)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]pentanoate.
| Compound Name | but-2-enyl (2S)-5-(diaminomethylideneamino)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]pentanoate |
|---|---|
| PubChem CID | 54418264 |
| Molecular Formula | C22H31N5O4S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | but-2-enyl (2S)-5-(diaminomethylideneamino)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]pentanoate |
| SMILES | CC=CCOC(=O)[C@H](CCCN=C(N)N)NS(=O)(=O)c1cccc2c(N(C)C)cccc12 |
| InChI | InChI=1S/C22H31N5O4S/c1-4-5-15-31-21(28)18(11-8-14-25-22(23)24)26-32(29,30)20-13-7-9-16-17(20)10-6-12-19(16)27(2)3/h4-7,9-10,12-13,18,26H,8,11,14-15H2,1-3H3,(H4,23,24,25)/t18-/m0/s1 |
| InChIKey | VYZGKZYGJHKXGB-SFHVURJKSA-N |
| XLogP | 1.73 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|