C25H38N6O3S — CID 10074781
2-[4-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-5-oxo-5-piperidin-1-ylpentyl]-1-ethylguanidine (PubChem CID 10074781) has the molecular formula C25H38N6O3S and a molecular weight of 502.69 g/mol. Its IUPAC name is 2-[4-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-5-oxo-5-piperidin-1-ylpentyl]-1-ethylguanidine.
| Compound Name | 2-[4-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-5-oxo-5-piperidin-1-ylpentyl]-1-ethylguanidine |
|---|---|
| PubChem CID | 10074781 |
| Molecular Formula | C25H38N6O3S |
| Molecular Weight | 502.69 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | 2-[4-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-5-oxo-5-piperidin-1-ylpentyl]-1-ethylguanidine |
| SMILES | CCN/C(N)=N/CCCC(NS(=O)(=O)c1cccc2c(N(C)C)cccc12)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C25H38N6O3S/c1-4-27-25(26)28-16-10-13-21(24(32)31-17-6-5-7-18-31)29-35(33,34)23-15-9-11-19-20(23)12-8-14-22(19)30(2)3/h8-9,11-12,14-15,21,29H,4-7,10,13,16-18H2,1-3H3,(H3,26,27,28) |
| InChIKey | SKIQSXUMPVXFMD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.69 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|