C29H50N10O3S — CID 155162183
(2R)-6-(diaminomethylideneamino)-2-[[(4R)-7-(diaminomethylideneamino)-4-[1-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]ethyl]heptan-2-yl]amino]hexanamide (PubChem CID 155162183) has the molecular formula C29H50N10O3S and a molecular weight of 618.85 g/mol. Its IUPAC name is (2R)-6-(diaminomethylideneamino)-2-[[(4R)-7-(diaminomethylideneamino)-4-[1-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]ethyl]heptan-2-yl]amino]hexanamide.
| Compound Name | (2R)-6-(diaminomethylideneamino)-2-[[(4R)-7-(diaminomethylideneamino)-4-[1-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]ethyl]heptan-2-yl]amino]hexanamide |
|---|---|
| PubChem CID | 155162183 |
| Molecular Formula | C29H50N10O3S |
| Molecular Weight | 618.85 g/mol |
| Exact Mass | 618.38 |
| IUPAC Name | (2R)-6-(diaminomethylideneamino)-2-[[(4R)-7-(diaminomethylideneamino)-4-[1-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]ethyl]heptan-2-yl]amino]hexanamide |
| SMILES | CC(C[C@@H](CCCN=C(N)N)C(C)NS(=O)(=O)c1cccc2c(N(C)C)cccc12)N[C@H](CCCCN=C(N)N)C(N)=O |
| InChI | InChI=1S/C29H50N10O3S/c1-19(37-24(27(30)40)13-5-6-16-35-28(31)32)18-21(10-9-17-36-29(33)34)20(2)38-43(41,42)26-15-8-11-22-23(26)12-7-14-25(22)39(3)4/h7-8,11-12,14-15,19-21,24,37-38H,5-6,9-10,13,16-18H2,1-4H3,(H2,30,40)(H4,31,32,35)(H4,33,34,36)/t19?,20?,21-,24-/m1/s1 |
| InChIKey | TYMGKSPHTTVMAD-XLYGXDRMSA-N |
| XLogP | 0.91 |
| TPSA | 233.33 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.85 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|