C19H27N3O4S — CID 142152400
methyl (2S)-6-amino-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexanoate (PubChem CID 142152400) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is methyl (2S)-6-amino-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexanoate.
| Compound Name | methyl (2S)-6-amino-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexanoate |
|---|---|
| PubChem CID | 142152400 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | methyl (2S)-6-amino-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCN)NS(=O)(=O)c1cccc2c(N(C)C)cccc12 |
| InChI | InChI=1S/C19H27N3O4S/c1-22(2)17-11-6-9-15-14(17)8-7-12-18(15)27(24,25)21-16(19(23)26-3)10-4-5-13-20/h6-9,11-12,16,21H,4-5,10,13,20H2,1-3H3/t16-/m0/s1 |
| InChIKey | DERDVXKUCQOHAM-INIZCTEOSA-N |
| XLogP | 1.85 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|