C20H32N6O3S — CID 10599067
2-[(4S)-4-[(3-methyl-1,2,3,4-tetrahydroquinolin-8-yl)sulfonylamino]-5-oxo-5-pyrrolidin-1-ylpentyl]guanidine (PubChem CID 10599067) has the molecular formula C20H32N6O3S and a molecular weight of 436.58 g/mol. Its IUPAC name is 2-[(4S)-4-[(3-methyl-1,2,3,4-tetrahydroquinolin-8-yl)sulfonylamino]-5-oxo-5-pyrrolidin-1-ylpentyl]guanidine.
| Compound Name | 2-[(4S)-4-[(3-methyl-1,2,3,4-tetrahydroquinolin-8-yl)sulfonylamino]-5-oxo-5-pyrrolidin-1-ylpentyl]guanidine |
|---|---|
| PubChem CID | 10599067 |
| Molecular Formula | C20H32N6O3S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 2-[(4S)-4-[(3-methyl-1,2,3,4-tetrahydroquinolin-8-yl)sulfonylamino]-5-oxo-5-pyrrolidin-1-ylpentyl]guanidine |
| SMILES | CC1CNc2c(cccc2S(=O)(=O)N[C@@H](CCCN=C(N)N)C(=O)N2CCCC2)C1 |
| InChI | InChI=1S/C20H32N6O3S/c1-14-12-15-6-4-8-17(18(15)24-13-14)30(28,29)25-16(7-5-9-23-20(21)22)19(27)26-10-2-3-11-26/h4,6,8,14,16,24-25H,2-3,5,7,9-13H2,1H3,(H4,21,22,23)/t14?,16-/m0/s1 |
| InChIKey | QRUHATKTTXZGEA-WMCAAGNKSA-N |
| XLogP | 0.61 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|