C22H36N6O4S — CID 10719537
2-[(4S)-5-[(3S)-3-(hydroxymethyl)piperidin-1-yl]-4-[(3-methyl-1,2,3,4-tetrahydroquinolin-8-yl)sulfonylamino]-5-oxopentyl]guanidine (PubChem CID 10719537) has the molecular formula C22H36N6O4S and a molecular weight of 480.64 g/mol. Its IUPAC name is 2-[(4S)-5-[(3S)-3-(hydroxymethyl)piperidin-1-yl]-4-[(3-methyl-1,2,3,4-tetrahydroquinolin-8-yl)sulfonylamino]-5-oxopentyl]guanidine.
| Compound Name | 2-[(4S)-5-[(3S)-3-(hydroxymethyl)piperidin-1-yl]-4-[(3-methyl-1,2,3,4-tetrahydroquinolin-8-yl)sulfonylamino]-5-oxopentyl]guanidine |
|---|---|
| PubChem CID | 10719537 |
| Molecular Formula | C22H36N6O4S |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | 2-[(4S)-5-[(3S)-3-(hydroxymethyl)piperidin-1-yl]-4-[(3-methyl-1,2,3,4-tetrahydroquinolin-8-yl)sulfonylamino]-5-oxopentyl]guanidine |
| SMILES | CC1CNc2c(cccc2S(=O)(=O)N[C@@H](CCCN=C(N)N)C(=O)N2CCC[C@H](CO)C2)C1 |
| InChI | InChI=1S/C22H36N6O4S/c1-15-11-17-6-2-8-19(20(17)26-12-15)33(31,32)27-18(7-3-9-25-22(23)24)21(30)28-10-4-5-16(13-28)14-29/h2,6,8,15-16,18,26-27,29H,3-5,7,9-14H2,1H3,(H4,23,24,25)/t15?,16-,18-/m0/s1 |
| InChIKey | UZNQGSNEUKICQP-YLGOGADGSA-N |
| XLogP | 0.22 |
| TPSA | 163.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|