C23H40N6O5S — CID 175137019
(2R,4R)-1-[5-(diaminomethylideneamino)-2-[(3-methyl-1,2,3,4-tetrahydroquinolin-8-yl)sulfonylamino]pentyl]-4-methylpiperidine-2-carboxylic acid;hydrate (PubChem CID 175137019) has the molecular formula C23H40N6O5S and a molecular weight of 512.68 g/mol. Its IUPAC name is (2R,4R)-1-[5-(diaminomethylideneamino)-2-[(3-methyl-1,2,3,4-tetrahydroquinolin-8-yl)sulfonylamino]pentyl]-4-methylpiperidine-2-carboxylic acid;hydrate.
| Compound Name | (2R,4R)-1-[5-(diaminomethylideneamino)-2-[(3-methyl-1,2,3,4-tetrahydroquinolin-8-yl)sulfonylamino]pentyl]-4-methylpiperidine-2-carboxylic acid;hydrate |
|---|---|
| PubChem CID | 175137019 |
| Molecular Formula | C23H40N6O5S |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | (2R,4R)-1-[5-(diaminomethylideneamino)-2-[(3-methyl-1,2,3,4-tetrahydroquinolin-8-yl)sulfonylamino]pentyl]-4-methylpiperidine-2-carboxylic acid;hydrate |
| SMILES | CC1CNc2c(cccc2S(=O)(=O)NC(CCCN=C(N)N)CN2CC[C@@H](C)C[C@@H]2C(=O)O)C1.O |
| InChI | InChI=1S/C23H38N6O4S.H2O/c1-15-8-10-29(19(12-15)22(30)31)14-18(6-4-9-26-23(24)25)28-34(32,33)20-7-3-5-17-11-16(2)13-27-21(17)20;/h3,5,7,15-16,18-19,27-28H,4,6,8-14H2,1-2H3,(H,30,31)(H4,24,25,26);1H2/t15-,16?,18?,19-;/m1./s1 |
| InChIKey | HTEHEMHGLBFWDZ-KEVGILTBSA-N |
| XLogP | 0.35 |
| TPSA | 194.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|