C26H44N6O5S — CID 143733545
1-[5-(diaminomethylideneamino)-2-[(1,3-dimethyl-3,4-dihydro-2H-quinolin-8-yl)sulfonylamino]pentanoyl]-4-methylpiperidine-2-carboxylic acid;ethane (PubChem CID 143733545) has the molecular formula C26H44N6O5S and a molecular weight of 552.74 g/mol. Its IUPAC name is 1-[5-(diaminomethylideneamino)-2-[(1,3-dimethyl-3,4-dihydro-2H-quinolin-8-yl)sulfonylamino]pentanoyl]-4-methylpiperidine-2-carboxylic acid;ethane.
| Compound Name | 1-[5-(diaminomethylideneamino)-2-[(1,3-dimethyl-3,4-dihydro-2H-quinolin-8-yl)sulfonylamino]pentanoyl]-4-methylpiperidine-2-carboxylic acid;ethane |
|---|---|
| PubChem CID | 143733545 |
| Molecular Formula | C26H44N6O5S |
| Molecular Weight | 552.74 g/mol |
| Exact Mass | 552.31 |
| IUPAC Name | 1-[5-(diaminomethylideneamino)-2-[(1,3-dimethyl-3,4-dihydro-2H-quinolin-8-yl)sulfonylamino]pentanoyl]-4-methylpiperidine-2-carboxylic acid;ethane |
| SMILES | CC.CC1CCN(C(=O)C(CCCN=C(N)N)NS(=O)(=O)c2cccc3c2N(C)CC(C)C3)C(C(=O)O)C1 |
| InChI | InChI=1S/C24H38N6O5S.C2H6/c1-15-9-11-30(19(13-15)23(32)33)22(31)18(7-5-10-27-24(25)26)28-36(34,35)20-8-4-6-17-12-16(2)14-29(3)21(17)20;1-2/h4,6,8,15-16,18-19,28H,5,7,9-14H2,1-3H3,(H,32,33)(H4,25,26,27);1-2H3 |
| InChIKey | DPYGPJQFTBOFRR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 171.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.74 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|