C24H39N5O6S — CID 70259180
(2R,4R)-1-[(2S)-5-(diaminomethylideneamino)-2-[(3,5-dimethyl-4-propoxyphenyl)sulfonylamino]pentanoyl]-4-methylpiperidine-2-carboxylic acid (PubChem CID 70259180) has the molecular formula C24H39N5O6S and a molecular weight of 525.67 g/mol. Its IUPAC name is (2R,4R)-1-[(2S)-5-(diaminomethylideneamino)-2-[(3,5-dimethyl-4-propoxyphenyl)sulfonylamino]pentanoyl]-4-methylpiperidine-2-carboxylic acid.
| Compound Name | (2R,4R)-1-[(2S)-5-(diaminomethylideneamino)-2-[(3,5-dimethyl-4-propoxyphenyl)sulfonylamino]pentanoyl]-4-methylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70259180 |
| Molecular Formula | C24H39N5O6S |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | (2R,4R)-1-[(2S)-5-(diaminomethylideneamino)-2-[(3,5-dimethyl-4-propoxyphenyl)sulfonylamino]pentanoyl]-4-methylpiperidine-2-carboxylic acid |
| SMILES | CCCOc1c(C)cc(S(=O)(=O)N[C@@H](CCCN=C(N)N)C(=O)N2CC[C@@H](C)C[C@@H]2C(=O)O)cc1C |
| InChI | InChI=1S/C24H39N5O6S/c1-5-11-35-21-16(3)13-18(14-17(21)4)36(33,34)28-19(7-6-9-27-24(25)26)22(30)29-10-8-15(2)12-20(29)23(31)32/h13-15,19-20,28H,5-12H2,1-4H3,(H,31,32)(H4,25,26,27)/t15-,19+,20-/m1/s1 |
| InChIKey | IWADBMZAPSXNND-UIAACRFSSA-N |
| XLogP | 1.50 |
| TPSA | 177.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|