C18H27N5O5S — CID 46899741
(2S)-1-[(2R)-2-(benzylsulfonylamino)-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 46899741) has the molecular formula C18H27N5O5S and a molecular weight of 425.51 g/mol. Its IUPAC name is (2S)-1-[(2R)-2-(benzylsulfonylamino)-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2R)-2-(benzylsulfonylamino)-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 46899741 |
| Molecular Formula | C18H27N5O5S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | (2S)-1-[(2R)-2-(benzylsulfonylamino)-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NC(N)=NCCC[C@@H](NS(=O)(=O)Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C18H27N5O5S/c19-18(20)21-10-4-8-14(16(24)23-11-5-9-15(23)17(25)26)22-29(27,28)12-13-6-2-1-3-7-13/h1-3,6-7,14-15,22H,4-5,8-12H2,(H,25,26)(H4,19,20,21)/t14-,15+/m1/s1 |
| InChIKey | QVUCKBLCHBSJOW-CABCVRRESA-N |
| XLogP | -0.40 |
| TPSA | 168.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|