C30H42N6O7S — CID 135531362
ethyl (2R,4R)-4-methyl-1-[(2S)-5-[[(E)-N'-nitrocarbamimidoyl]amino]-2-[[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]pentanoyl]piperidine-2-carboxylate (PubChem CID 135531362) has the molecular formula C30H42N6O7S and a molecular weight of 630.77 g/mol. Its IUPAC name is ethyl (2R,4R)-4-methyl-1-[(2S)-5-[[(E)-N'-nitrocarbamimidoyl]amino]-2-[[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]pentanoyl]piperidine-2-carboxylate.
| Compound Name | ethyl (2R,4R)-4-methyl-1-[(2S)-5-[[(E)-N'-nitrocarbamimidoyl]amino]-2-[[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]pentanoyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 135531362 |
| Molecular Formula | C30H42N6O7S |
| Molecular Weight | 630.77 g/mol |
| Exact Mass | 630.28 |
| IUPAC Name | ethyl (2R,4R)-4-methyl-1-[(2S)-5-[[(E)-N'-nitrocarbamimidoyl]amino]-2-[[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]pentanoyl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@H](C)CCN1C(=O)[C@H](CCCN/C(N)=N/[N+](=O)[O-])NS(=O)(=O)c1cccc(C(C)(C)c2ccccc2)c1 |
| InChI | InChI=1S/C30H42N6O7S/c1-5-43-28(38)26-19-21(2)16-18-35(26)27(37)25(15-10-17-32-29(31)33-36(39)40)34-44(41,42)24-14-9-13-23(20-24)30(3,4)22-11-7-6-8-12-22/h6-9,11-14,20-21,25-26,34H,5,10,15-19H2,1-4H3,(H3,31,32,33)/t21-,25+,26-/m1/s1 |
| InChIKey | ODMIADGIXFNOGH-QGUKFAFCSA-N |
| XLogP | 2.73 |
| TPSA | 186.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.77 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|