C28H41N5O6S2 — CID 23198972
2-[1-[5-(diaminomethylideneamino)-2-[[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]pentanoyl]piperidin-4-yl]ethanesulfonic acid (PubChem CID 23198972) has the molecular formula C28H41N5O6S2 and a molecular weight of 607.80 g/mol. Its IUPAC name is 2-[1-[5-(diaminomethylideneamino)-2-[[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]pentanoyl]piperidin-4-yl]ethanesulfonic acid.
| Compound Name | 2-[1-[5-(diaminomethylideneamino)-2-[[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]pentanoyl]piperidin-4-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 23198972 |
| Molecular Formula | C28H41N5O6S2 |
| Molecular Weight | 607.80 g/mol |
| Exact Mass | 607.25 |
| IUPAC Name | 2-[1-[5-(diaminomethylideneamino)-2-[[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]pentanoyl]piperidin-4-yl]ethanesulfonic acid |
| SMILES | CC(C)(c1ccccc1)c1cccc(S(=O)(=O)NC(CCCN=C(N)N)C(=O)N2CCC(CCS(=O)(=O)O)CC2)c1 |
| InChI | InChI=1S/C28H41N5O6S2/c1-28(2,22-8-4-3-5-9-22)23-10-6-11-24(20-23)41(38,39)32-25(12-7-16-31-27(29)30)26(34)33-17-13-21(14-18-33)15-19-40(35,36)37/h3-6,8-11,20-21,25,32H,7,12-19H2,1-2H3,(H4,29,30,31)(H,35,36,37) |
| InChIKey | XAINKPWVQOZBBZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 185.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.80 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|