C27H33ClN6O4S — CID 14232896
2-[(4S)-5-[4-(2-chlorophenyl)piperazin-1-yl]-4-[(7-methoxynaphthalen-2-yl)sulfonylamino]-5-oxopentyl]guanidine (PubChem CID 14232896) has the molecular formula C27H33ClN6O4S and a molecular weight of 573.12 g/mol. Its IUPAC name is 2-[(4S)-5-[4-(2-chlorophenyl)piperazin-1-yl]-4-[(7-methoxynaphthalen-2-yl)sulfonylamino]-5-oxopentyl]guanidine.
| Compound Name | 2-[(4S)-5-[4-(2-chlorophenyl)piperazin-1-yl]-4-[(7-methoxynaphthalen-2-yl)sulfonylamino]-5-oxopentyl]guanidine |
|---|---|
| PubChem CID | 14232896 |
| Molecular Formula | C27H33ClN6O4S |
| Molecular Weight | 573.12 g/mol |
| Exact Mass | 572.20 |
| IUPAC Name | 2-[(4S)-5-[4-(2-chlorophenyl)piperazin-1-yl]-4-[(7-methoxynaphthalen-2-yl)sulfonylamino]-5-oxopentyl]guanidine |
| SMILES | COc1ccc2ccc(S(=O)(=O)N[C@@H](CCCN=C(N)N)C(=O)N3CCN(c4ccccc4Cl)CC3)cc2c1 |
| InChI | InChI=1S/C27H33ClN6O4S/c1-38-21-10-8-19-9-11-22(18-20(19)17-21)39(36,37)32-24(6-4-12-31-27(29)30)26(35)34-15-13-33(14-16-34)25-7-3-2-5-23(25)28/h2-3,5,7-11,17-18,24,32H,4,6,12-16H2,1H3,(H4,29,30,31)/t24-/m0/s1 |
| InChIKey | JWKYJRNAMHELOE-DEOSSOPVSA-N |
| XLogP | 2.55 |
| TPSA | 143.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.12 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|