C24H33N7O7S — CID 86734950
2-[[(2S)-5-(diaminomethylideneamino)-2-[(7-methoxynaphthalen-2-yl)sulfonylamino]pentanoyl]-(oxolan-2-ylmethyl)amino]acetic acid;molecular nitrogen (PubChem CID 86734950) has the molecular formula C24H33N7O7S and a molecular weight of 563.64 g/mol. Its IUPAC name is 2-[[(2S)-5-(diaminomethylideneamino)-2-[(7-methoxynaphthalen-2-yl)sulfonylamino]pentanoyl]-(oxolan-2-ylmethyl)amino]acetic acid;molecular nitrogen.
| Compound Name | 2-[[(2S)-5-(diaminomethylideneamino)-2-[(7-methoxynaphthalen-2-yl)sulfonylamino]pentanoyl]-(oxolan-2-ylmethyl)amino]acetic acid;molecular nitrogen |
|---|---|
| PubChem CID | 86734950 |
| Molecular Formula | C24H33N7O7S |
| Molecular Weight | 563.64 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | 2-[[(2S)-5-(diaminomethylideneamino)-2-[(7-methoxynaphthalen-2-yl)sulfonylamino]pentanoyl]-(oxolan-2-ylmethyl)amino]acetic acid;molecular nitrogen |
| SMILES | COc1ccc2ccc(S(=O)(=O)N[C@@H](CCCN=C(N)N)C(=O)N(CC(=O)O)CC3CCCO3)cc2c1.N#N |
| InChI | InChI=1S/C24H33N5O7S.N2/c1-35-18-8-6-16-7-9-20(13-17(16)12-18)37(33,34)28-21(5-2-10-27-24(25)26)23(32)29(15-22(30)31)14-19-4-3-11-36-19;1-2/h6-9,12-13,19,21,28H,2-5,10-11,14-15H2,1H3,(H,30,31)(H4,25,26,27);/t19?,21-;/m0./s1 |
| InChIKey | LIMHXVYPDQDEDP-ANQAEFHNSA-N |
| XLogP | 0.67 |
| TPSA | 234.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.64 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|