C18H25ClN6O5S — CID 86735332
methyl (2S)-5-(diaminomethylideneamino)-2-[(7-methoxynaphthalen-2-yl)sulfonylamino]pentanoate;molecular nitrogen;hydrochloride (PubChem CID 86735332) has the molecular formula C18H25ClN6O5S and a molecular weight of 472.96 g/mol. Its IUPAC name is methyl (2S)-5-(diaminomethylideneamino)-2-[(7-methoxynaphthalen-2-yl)sulfonylamino]pentanoate;molecular nitrogen;hydrochloride.
| Compound Name | methyl (2S)-5-(diaminomethylideneamino)-2-[(7-methoxynaphthalen-2-yl)sulfonylamino]pentanoate;molecular nitrogen;hydrochloride |
|---|---|
| PubChem CID | 86735332 |
| Molecular Formula | C18H25ClN6O5S |
| Molecular Weight | 472.96 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | methyl (2S)-5-(diaminomethylideneamino)-2-[(7-methoxynaphthalen-2-yl)sulfonylamino]pentanoate;molecular nitrogen;hydrochloride |
| SMILES | COC(=O)[C@H](CCCN=C(N)N)NS(=O)(=O)c1ccc2ccc(OC)cc2c1.Cl.N#N |
| InChI | InChI=1S/C18H24N4O5S.ClH.N2/c1-26-14-7-5-12-6-8-15(11-13(12)10-14)28(24,25)22-16(17(23)27-2)4-3-9-21-18(19)20;;1-2/h5-8,10-11,16,22H,3-4,9H2,1-2H3,(H4,19,20,21);1H;/t16-;;/m0../s1 |
| InChIKey | ABUMSJKKRSRXBU-SQKCAUCHSA-N |
| XLogP | 1.17 |
| TPSA | 193.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.96 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|