C18H23N5O5S — CID 67562975
amino (2R)-5-(diaminomethylideneamino)-2-[(4-phenoxyphenyl)sulfonylamino]pentanoate (PubChem CID 67562975) has the molecular formula C18H23N5O5S and a molecular weight of 421.48 g/mol. Its IUPAC name is amino (2R)-5-(diaminomethylideneamino)-2-[(4-phenoxyphenyl)sulfonylamino]pentanoate.
| Compound Name | amino (2R)-5-(diaminomethylideneamino)-2-[(4-phenoxyphenyl)sulfonylamino]pentanoate |
|---|---|
| PubChem CID | 67562975 |
| Molecular Formula | C18H23N5O5S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | amino (2R)-5-(diaminomethylideneamino)-2-[(4-phenoxyphenyl)sulfonylamino]pentanoate |
| SMILES | NOC(=O)[C@@H](CCCN=C(N)N)NS(=O)(=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C18H23N5O5S/c19-18(20)22-12-4-7-16(17(24)28-21)23-29(25,26)15-10-8-14(9-11-15)27-13-5-2-1-3-6-13/h1-3,5-6,8-11,16,23H,4,7,12,21H2,(H4,19,20,22)/t16-/m1/s1 |
| InChIKey | DTMYEWMRALZPKR-MRXNPFEDSA-N |
| XLogP | 0.60 |
| TPSA | 172.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|