C18H21ClFN5O5S — CID 10238779
(2R)-2-[[4-(4-chlorophenoxy)-3-fluorophenyl]sulfonylamino]-5-(diaminomethylideneamino)-N-hydroxypentanamide (PubChem CID 10238779) has the molecular formula C18H21ClFN5O5S and a molecular weight of 473.91 g/mol. Its IUPAC name is (2R)-2-[[4-(4-chlorophenoxy)-3-fluorophenyl]sulfonylamino]-5-(diaminomethylideneamino)-N-hydroxypentanamide.
| Compound Name | (2R)-2-[[4-(4-chlorophenoxy)-3-fluorophenyl]sulfonylamino]-5-(diaminomethylideneamino)-N-hydroxypentanamide |
|---|---|
| PubChem CID | 10238779 |
| Molecular Formula | C18H21ClFN5O5S |
| Molecular Weight | 473.91 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | (2R)-2-[[4-(4-chlorophenoxy)-3-fluorophenyl]sulfonylamino]-5-(diaminomethylideneamino)-N-hydroxypentanamide |
| SMILES | NC(N)=NCCC[C@@H](NS(=O)(=O)c1ccc(Oc2ccc(Cl)cc2)c(F)c1)C(=O)NO |
| InChI | InChI=1S/C18H21ClFN5O5S/c19-11-3-5-12(6-4-11)30-16-8-7-13(10-14(16)20)31(28,29)25-15(17(26)24-27)2-1-9-23-18(21)22/h3-8,10,15,25,27H,1-2,9H2,(H,24,26)(H4,21,22,23)/t15-/m1/s1 |
| InChIKey | HGCHDOMAPROBKS-OAHLLOKOSA-N |
| XLogP | 1.48 |
| TPSA | 169.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.91 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|