C22H27F2N3O5S — CID 87293282
3-[4-(aminomethyl)cyclohexyl]-2-[[3-fluoro-4-(4-fluorophenoxy)phenyl]sulfonylamino]-N-hydroxypropanamide (PubChem CID 87293282) has the molecular formula C22H27F2N3O5S and a molecular weight of 483.54 g/mol. Its IUPAC name is 3-[4-(aminomethyl)cyclohexyl]-2-[[3-fluoro-4-(4-fluorophenoxy)phenyl]sulfonylamino]-N-hydroxypropanamide.
| Compound Name | 3-[4-(aminomethyl)cyclohexyl]-2-[[3-fluoro-4-(4-fluorophenoxy)phenyl]sulfonylamino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 87293282 |
| Molecular Formula | C22H27F2N3O5S |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 3-[4-(aminomethyl)cyclohexyl]-2-[[3-fluoro-4-(4-fluorophenoxy)phenyl]sulfonylamino]-N-hydroxypropanamide |
| SMILES | NCC1CCC(CC(NS(=O)(=O)c2ccc(Oc3ccc(F)cc3)c(F)c2)C(=O)NO)CC1 |
| InChI | InChI=1S/C22H27F2N3O5S/c23-16-5-7-17(8-6-16)32-21-10-9-18(12-19(21)24)33(30,31)27-20(22(28)26-29)11-14-1-3-15(13-25)4-2-14/h5-10,12,14-15,20,27,29H,1-4,11,13,25H2,(H,26,28) |
| InChIKey | DCIOYAAVFDJNQF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|