C20H26FN5O5S — CID 10173993
(2R)-5-(diaminomethylideneamino)-2-[[4-(3,5-dimethylphenoxy)-3-fluorophenyl]sulfonylamino]-N-hydroxypentanamide (PubChem CID 10173993) has the molecular formula C20H26FN5O5S and a molecular weight of 467.52 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-2-[[4-(3,5-dimethylphenoxy)-3-fluorophenyl]sulfonylamino]-N-hydroxypentanamide.
| Compound Name | (2R)-5-(diaminomethylideneamino)-2-[[4-(3,5-dimethylphenoxy)-3-fluorophenyl]sulfonylamino]-N-hydroxypentanamide |
|---|---|
| PubChem CID | 10173993 |
| Molecular Formula | C20H26FN5O5S |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-2-[[4-(3,5-dimethylphenoxy)-3-fluorophenyl]sulfonylamino]-N-hydroxypentanamide |
| SMILES | Cc1cc(C)cc(Oc2ccc(S(=O)(=O)N[C@H](CCCN=C(N)N)C(=O)NO)cc2F)c1 |
| InChI | InChI=1S/C20H26FN5O5S/c1-12-8-13(2)10-14(9-12)31-18-6-5-15(11-16(18)21)32(29,30)26-17(19(27)25-28)4-3-7-24-20(22)23/h5-6,8-11,17,26,28H,3-4,7H2,1-2H3,(H,25,27)(H4,22,23,24)/t17-/m1/s1 |
| InChIKey | ZELXBNSAHMEUAR-QGZVFWFLSA-N |
| XLogP | 1.44 |
| TPSA | 169.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|