C16H29N5O7S — CID 131665058
(2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[(4-methylphenyl)sulfonylamino]propanoyl]amino]pentanoic acid;dihydrate (PubChem CID 131665058) has the molecular formula C16H29N5O7S and a molecular weight of 435.50 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[(4-methylphenyl)sulfonylamino]propanoyl]amino]pentanoic acid;dihydrate.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[(4-methylphenyl)sulfonylamino]propanoyl]amino]pentanoic acid;dihydrate |
|---|---|
| PubChem CID | 131665058 |
| Molecular Formula | C16H29N5O7S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[(4-methylphenyl)sulfonylamino]propanoyl]amino]pentanoic acid;dihydrate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)O)cc1.O.O |
| InChI | InChI=1S/C16H25N5O5S.2H2O/c1-10-5-7-12(8-6-10)27(25,26)21-11(2)14(22)20-13(15(23)24)4-3-9-19-16(17)18;;/h5-8,11,13,21H,3-4,9H2,1-2H3,(H,20,22)(H,23,24)(H4,17,18,19);2*1H2/t11-,13-;;/m0../s1 |
| InChIKey | ZJIMNIFCMSDELP-JBUFHSOLSA-N |
| XLogP | -2.36 |
| TPSA | 239.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|